C11H10Cl4Sn — CID 10431244
trichloro-[(1S,8R,9R,10S)-10-chloro-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]stannane (PubChem CID 10431244) has the molecular formula C11H10Cl4Sn and a molecular weight of 402.72 g/mol. Its IUPAC name is trichloro-[(1S,8R,9R,10S)-10-chloro-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]stannane.
| Compound Name | trichloro-[(1S,8R,9R,10S)-10-chloro-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]stannane |
|---|---|
| PubChem CID | 10431244 |
| Molecular Formula | C11H10Cl4Sn |
| Molecular Weight | 402.72 g/mol |
| Exact Mass | 401.86 |
| IUPAC Name | trichloro-[(1S,8R,9R,10S)-10-chloro-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]stannane |
| SMILES | Cl[C@@H]1[C@H]([Sn](Cl)(Cl)Cl)[C@@H]2C[C@H]1c1ccccc12 |
| InChI | InChI=1S/C11H10Cl.3ClH.Sn/c12-11-6-7-5-10(11)9-4-2-1-3-8(7)9;;;;/h1-4,6-7,10-11H,5H2;3*1H;/q;;;;+3/p-3/t7-,10-,11+;;;;/m0..../s1 |
| InChIKey | JCXJPKRNKJZBBS-ZTEYXKGHSA-K |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.72 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|