C23H33NO3S — CID 10431288
7-[(2R)-2-[(E,3S)-4-(3-ethylphenyl)-3-hydroxybut-1-enyl]-5-sulfanylidenepyrrolidin-1-yl]heptanoic acid (PubChem CID 10431288) has the molecular formula C23H33NO3S and a molecular weight of 403.59 g/mol. Its IUPAC name is 7-[(2R)-2-[(E,3S)-4-(3-ethylphenyl)-3-hydroxybut-1-enyl]-5-sulfanylidenepyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-[(E,3S)-4-(3-ethylphenyl)-3-hydroxybut-1-enyl]-5-sulfanylidenepyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 10431288 |
| Molecular Formula | C23H33NO3S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 7-[(2R)-2-[(E,3S)-4-(3-ethylphenyl)-3-hydroxybut-1-enyl]-5-sulfanylidenepyrrolidin-1-yl]heptanoic acid |
| SMILES | CCc1cccc(C[C@H](O)/C=C/[C@H]2CCC(=S)N2CCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C23H33NO3S/c1-2-18-8-7-9-19(16-18)17-21(25)13-11-20-12-14-22(28)24(20)15-6-4-3-5-10-23(26)27/h7-9,11,13,16,20-21,25H,2-6,10,12,14-15,17H2,1H3,(H,26,27)/b13-11+/t20-,21+/m0/s1 |
| InChIKey | ZIITVQOTJQQBNL-BCYJJVOOSA-N |
| XLogP | 4.54 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|