C21H32O6Si — CID 10431601
dimethyl 2',2'-dimethyl-4-trimethylsilylspiro[1,3,4,7-tetrahydroindene-2,5'-1,3-dioxane]-5,6-dicarboxylate (PubChem CID 10431601) has the molecular formula C21H32O6Si and a molecular weight of 408.57 g/mol. Its IUPAC name is dimethyl 2',2'-dimethyl-4-trimethylsilylspiro[1,3,4,7-tetrahydroindene-2,5'-1,3-dioxane]-5,6-dicarboxylate.
| Compound Name | dimethyl 2',2'-dimethyl-4-trimethylsilylspiro[1,3,4,7-tetrahydroindene-2,5'-1,3-dioxane]-5,6-dicarboxylate |
|---|---|
| PubChem CID | 10431601 |
| Molecular Formula | C21H32O6Si |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | dimethyl 2',2'-dimethyl-4-trimethylsilylspiro[1,3,4,7-tetrahydroindene-2,5'-1,3-dioxane]-5,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C([Si](C)(C)C)C2=C(C1)CC1(COC(C)(C)OC1)C2 |
| InChI | InChI=1S/C21H32O6Si/c1-20(2)26-11-21(12-27-20)9-13-8-14(18(22)24-3)16(19(23)25-4)17(15(13)10-21)28(5,6)7/h17H,8-12H2,1-7H3 |
| InChIKey | SWTXHCXVQHSIFD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|