About (5-tert-butyl-1,3-dithian-2-yl)-methyl-diphenylphosphanium chloride
(5-tert-butyl-1,3-dithian-2-yl)-methyl-diphenylphosphanium chloride (PubChem CID 10431723) has the molecular formula C21H28ClPS2
and a molecular weight of 411.02 g/mol. Its IUPAC name is (5-tert-butyl-1,3-dithian-2-yl)-methyl-diphenylphosphanium chloride.
Molecular Properties
| Compound Name | (5-tert-butyl-1,3-dithian-2-yl)-methyl-diphenylphosphanium chloride |
| PubChem CID | 10431723 |
| Molecular Formula | C21H28ClPS2 |
| Molecular Weight | 411.02 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (5-tert-butyl-1,3-dithian-2-yl)-methyl-diphenylphosphanium chloride |
| SMILES | CC(C)(C)C1CSC([P+](C)(c2ccccc2)c2ccccc2)SC1.[Cl-] |
| InChI | InChI=1S/C21H28PS2.ClH/c1-21(2,3)17-15-23-20(24-16-17)22(4,18-11-7-5-8-12-18)19-13-9-6-10-14-19;/h5-14,17,20H,15-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | FSQMCQXBEQEDQI-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.02 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (5-tert-butyl-1,3-dithian-2-yl)-methyl-diphenylphosphanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-tert-butyl-1,3-dithian-2-yl)-methyl-diphenylphosphanium chloride?
The IUPAC name of (5-tert-butyl-1,3-dithian-2-yl)-methyl-diphenylphosphanium chloride (CID 10431723) is (5-tert-butyl-1,3-dithian-2-yl)-methyl-diphenylphosphanium chloride.
What is the SMILES notation for (5-tert-butyl-1,3-dithian-2-yl)-methyl-diphenylphosphanium chloride?
The canonical SMILES for (5-tert-butyl-1,3-dithian-2-yl)-methyl-diphenylphosphanium chloride is CC(C)(C)C1CSC([P+](C)(c2ccccc2)c2ccccc2)SC1.[Cl-].
What is the InChIKey of (5-tert-butyl-1,3-dithian-2-yl)-methyl-diphenylphosphanium chloride?
The InChIKey is FSQMCQXBEQEDQI-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H28PS2.ClH/c1-21(2,3)17-15-23-20(24-16-17)22(4,18-11-7-5-8-12-18)19-13-9-6-10-14-19;/h5-14,17,20H,15-16H2,1-4H3;1H/q+1;/p-1.
What are the key properties of (5-tert-butyl-1,3-dithian-2-yl)-methyl-diphenylphosphanium chloride?
(5-tert-butyl-1,3-dithian-2-yl)-methyl-diphenylphosphanium chloride has a molecular weight of 411.02 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-tert-butyl-1,3-dithian-2-yl)-methyl-diphenylphosphanium chloride is sourced from PubChem (CID 10431723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).