About 1-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylurea
1-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylurea (PubChem CID 10431761) has the molecular formula C22H25N3O3S
and a molecular weight of 411.53 g/mol. Its IUPAC name is 1-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylurea.
Molecular Properties
| Compound Name | 1-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylurea |
| PubChem CID | 10431761 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 1-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylurea |
| SMILES | COc1ccc(-c2nc(CNC(=O)NC(C)C)sc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H25N3O3S/c1-14(2)24-22(26)23-13-19-25-20(15-5-9-17(27-3)10-6-15)21(29-19)16-7-11-18(28-4)12-8-16/h5-12,14H,13H2,1-4H3,(H2,23,24,26) |
| InChIKey | NYXXPZVQPYBCFY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylurea?
The IUPAC name of 1-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylurea (CID 10431761) is 1-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylurea.
What is the SMILES notation for 1-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylurea?
The canonical SMILES for 1-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylurea is COc1ccc(-c2nc(CNC(=O)NC(C)C)sc2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 1-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylurea?
The InChIKey is NYXXPZVQPYBCFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O3S/c1-14(2)24-22(26)23-13-19-25-20(15-5-9-17(27-3)10-6-15)21(29-19)16-7-11-18(28-4)12-8-16/h5-12,14H,13H2,1-4H3,(H2,23,24,26).
What are the key properties of 1-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylurea?
1-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylurea has a molecular weight of 411.53 g/mol, XLogP of 4.70, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-3-propan-2-ylurea is sourced from PubChem (CID 10431761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).