C25H33NO4 — CID 10431762
2-[3-[2-(4,5-dicyclohexyl-1,3-oxazol-2-yl)ethyl]phenoxy]acetic acid (PubChem CID 10431762) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is 2-[3-[2-(4,5-dicyclohexyl-1,3-oxazol-2-yl)ethyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[2-(4,5-dicyclohexyl-1,3-oxazol-2-yl)ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10431762 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 2-[3-[2-(4,5-dicyclohexyl-1,3-oxazol-2-yl)ethyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(CCc2nc(C3CCCCC3)c(C3CCCCC3)o2)c1 |
| InChI | InChI=1S/C25H33NO4/c27-23(28)17-29-21-13-7-8-18(16-21)14-15-22-26-24(19-9-3-1-4-10-19)25(30-22)20-11-5-2-6-12-20/h7-8,13,16,19-20H,1-6,9-12,14-15,17H2,(H,27,28) |
| InChIKey | CUNCZZQVROQQQJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |