About 1-[4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-3-methoxyphenyl]ethanone
1-[4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-3-methoxyphenyl]ethanone (PubChem CID 10431812) has the molecular formula C23H25FN2O4
and a molecular weight of 412.46 g/mol. Its IUPAC name is 1-[4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-3-methoxyphenyl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-3-methoxyphenyl]ethanone |
| PubChem CID | 10431812 |
| Molecular Formula | C23H25FN2O4 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1-[4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-3-methoxyphenyl]ethanone |
| SMILES | COc1cc(C(C)=O)ccc1OCCN1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C23H25FN2O4/c1-15(27)17-3-6-20(22(13-17)28-2)29-12-11-26-9-7-16(8-10-26)23-19-5-4-18(24)14-21(19)30-25-23/h3-6,13-14,16H,7-12H2,1-2H3 |
| InChIKey | GUFAQOUWNNKLJJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-3-methoxyphenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-3-methoxyphenyl]ethanone?
The IUPAC name of 1-[4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-3-methoxyphenyl]ethanone (CID 10431812) is 1-[4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-3-methoxyphenyl]ethanone.
What is the SMILES notation for 1-[4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-3-methoxyphenyl]ethanone?
The canonical SMILES for 1-[4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-3-methoxyphenyl]ethanone is COc1cc(C(C)=O)ccc1OCCN1CCC(c2noc3cc(F)ccc23)CC1.
What is the InChIKey of 1-[4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-3-methoxyphenyl]ethanone?
The InChIKey is GUFAQOUWNNKLJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25FN2O4/c1-15(27)17-3-6-20(22(13-17)28-2)29-12-11-26-9-7-16(8-10-26)23-19-5-4-18(24)14-21(19)30-25-23/h3-6,13-14,16H,7-12H2,1-2H3.
What are the key properties of 1-[4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-3-methoxyphenyl]ethanone?
1-[4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-3-methoxyphenyl]ethanone has a molecular weight of 412.46 g/mol, XLogP of 4.44, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]-3-methoxyphenyl]ethanone is sourced from PubChem (CID 10431812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).