C28H47NO — CID 10431903
(NZ)-N-[(5R,8S,9S,10S,13R,14S,17R)-1,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine (PubChem CID 10431903) has the molecular formula C28H47NO and a molecular weight of 413.69 g/mol. Its IUPAC name is (NZ)-N-[(5R,8S,9S,10S,13R,14S,17R)-1,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(5R,8S,9S,10S,13R,14S,17R)-1,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 10431903 |
| Molecular Formula | C28H47NO |
| Molecular Weight | 413.69 g/mol |
| Exact Mass | 413.37 |
| IUPAC Name | (NZ)-N-[(5R,8S,9S,10S,13R,14S,17R)-1,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]hydroxylamine |
| SMILES | CC1=C/C(=N\O)C[C@H]2CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]3[C@@]12C |
| InChI | InChI=1S/C28H47NO/c1-18(2)8-7-9-19(3)24-12-13-25-23-11-10-21-17-22(29-30)16-20(4)28(21,6)26(23)14-15-27(24,25)5/h16,18-19,21,23-26,30H,7-15,17H2,1-6H3/b29-22+/t19-,21-,23+,24-,25+,26+,27-,28+/m1/s1 |
| InChIKey | ORMKERCTGBESMN-YFFBDUEJSA-N |
| XLogP | 8.10 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.69 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|