C19H24N6O5 — CID 10432051
(2S,3S,4R,5R)-5-[6-amino-2-[2-(1-hydroxycyclopentyl)ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 10432051) has the molecular formula C19H24N6O5 and a molecular weight of 416.44 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-amino-2-[2-(1-hydroxycyclopentyl)ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-amino-2-[2-(1-hydroxycyclopentyl)ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 10432051 |
| Molecular Formula | C19H24N6O5 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-amino-2-[2-(1-hydroxycyclopentyl)ethynyl]purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(C#CC4(O)CCCC4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H24N6O5/c1-2-21-17(28)14-12(26)13(27)18(30-14)25-9-22-11-15(20)23-10(24-16(11)25)5-8-19(29)6-3-4-7-19/h9,12-14,18,26-27,29H,2-4,6-7H2,1H3,(H,21,28)(H2,20,23,24)/t12-,13+,14-,18+/m0/s1 |
| InChIKey | SYXSCACZBVVAPD-MOROJQBDSA-N |
| XLogP | -1.18 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|