C27H22N2O3 — CID 10432364
4-hydroxy-3,6-bis(1H-indol-3-yl)-5-(3-methylbut-2-enyl)cyclohexa-3,5-diene-1,2-dione (PubChem CID 10432364) has the molecular formula C27H22N2O3 and a molecular weight of 422.48 g/mol. Its IUPAC name is 4-hydroxy-3,6-bis(1H-indol-3-yl)-5-(3-methylbut-2-enyl)cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 4-hydroxy-3,6-bis(1H-indol-3-yl)-5-(3-methylbut-2-enyl)cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 10432364 |
| Molecular Formula | C27H22N2O3 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 4-hydroxy-3,6-bis(1H-indol-3-yl)-5-(3-methylbut-2-enyl)cyclohexa-3,5-diene-1,2-dione |
| SMILES | CC(C)=CCC1=C(c2c[nH]c3ccccc23)C(=O)C(=O)C(c2c[nH]c3ccccc23)=C1O |
| InChI | InChI=1S/C27H22N2O3/c1-15(2)11-12-18-23(19-13-28-21-9-5-3-7-16(19)21)26(31)27(32)24(25(18)30)20-14-29-22-10-6-4-8-17(20)22/h3-11,13-14,28-30H,12H2,1-2H3 |
| InChIKey | KTLJMAJOQBABFT-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|