C26H34N2O3 — CID 10432384
2-cycloheptyl-4-(7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 10432384) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-cycloheptyl-4-(7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | 2-cycloheptyl-4-(7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 10432384 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 2-cycloheptyl-4-(7-methoxy-2,2-dimethyl-3H-1-benzofuran-4-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(C3CCCCCC3)C(=O)C3CC=CCC23)c2c1OC(C)(C)C2 |
| InChI | InChI=1S/C26H34N2O3/c1-26(2)16-21-19(14-15-22(30-3)24(21)31-26)23-18-12-8-9-13-20(18)25(29)28(27-23)17-10-6-4-5-7-11-17/h8-9,14-15,17-18,20H,4-7,10-13,16H2,1-3H3 |
| InChIKey | WPKUFAIEVOBXTL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|