C25H29NO5 — CID 10432415
dimethyl (3R,6R)-2-phenyl-6-[(E)-2-phenylethenyl]-3-propan-2-yloxazinane-4,4-dicarboxylate (PubChem CID 10432415) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is dimethyl (3R,6R)-2-phenyl-6-[(E)-2-phenylethenyl]-3-propan-2-yloxazinane-4,4-dicarboxylate.
| Compound Name | dimethyl (3R,6R)-2-phenyl-6-[(E)-2-phenylethenyl]-3-propan-2-yloxazinane-4,4-dicarboxylate |
|---|---|
| PubChem CID | 10432415 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | dimethyl (3R,6R)-2-phenyl-6-[(E)-2-phenylethenyl]-3-propan-2-yloxazinane-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](/C=C/c2ccccc2)ON(c2ccccc2)[C@@H]1C(C)C |
| InChI | InChI=1S/C25H29NO5/c1-18(2)22-25(23(27)29-3,24(28)30-4)17-21(16-15-19-11-7-5-8-12-19)31-26(22)20-13-9-6-10-14-20/h5-16,18,21-22H,17H2,1-4H3/b16-15+/t21-,22+/m0/s1 |
| InChIKey | BZHRMUTXNGTBLA-BJPOSOMNSA-N |
| XLogP | 4.27 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|