C26H36O5 — CID 10432730
methyl (Z)-7-[(1R,4S,5R)-4-hydroxy-5-[(E)-3-hydroxy-5-phenylpent-1-enyl]-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate (PubChem CID 10432730) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,4S,5R)-4-hydroxy-5-[(E)-3-hydroxy-5-phenylpent-1-enyl]-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,4S,5R)-4-hydroxy-5-[(E)-3-hydroxy-5-phenylpent-1-enyl]-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 10432730 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | methyl (Z)-7-[(1R,4S,5R)-4-hydroxy-5-[(E)-3-hydroxy-5-phenylpent-1-enyl]-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@H]1C(=O)C(C)(C)[C@@H](O)[C@@H]1/C=C/C(O)CCc1ccccc1 |
| InChI | InChI=1S/C26H36O5/c1-26(2)24(29)21(13-9-4-5-10-14-23(28)31-3)22(25(26)30)18-17-20(27)16-15-19-11-7-6-8-12-19/h4,6-9,11-12,17-18,20-22,25,27,30H,5,10,13-16H2,1-3H3/b9-4-,18-17+/t20?,21-,22-,25+/m1/s1 |
| InChIKey | ZELKHLBDQHQEJW-NRBAOQCDSA-N |
| XLogP | 4.03 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|