About 6-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylhexanamide
6-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylhexanamide (PubChem CID 10432801) has the molecular formula C25H35NO3S
and a molecular weight of 429.63 g/mol. Its IUPAC name is 6-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylhexanamide.
Molecular Properties
| Compound Name | 6-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylhexanamide |
| PubChem CID | 10432801 |
| Molecular Formula | C25H35NO3S |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 6-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylhexanamide |
| SMILES | CCCCN(C)C(=O)CCCCCSC(Cc1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C25H35NO3S/c1-3-4-17-26(2)25(29)8-6-5-7-18-30-24(21-11-15-23(28)16-12-21)19-20-9-13-22(27)14-10-20/h9-16,24,27-28H,3-8,17-19H2,1-2H3 |
| InChIKey | IWNRXDASBQTUKA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylhexanamide?
The IUPAC name of 6-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylhexanamide (CID 10432801) is 6-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylhexanamide.
What is the SMILES notation for 6-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylhexanamide?
The canonical SMILES for 6-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylhexanamide is CCCCN(C)C(=O)CCCCCSC(Cc1ccc(O)cc1)c1ccc(O)cc1.
What is the InChIKey of 6-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylhexanamide?
The InChIKey is IWNRXDASBQTUKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H35NO3S/c1-3-4-17-26(2)25(29)8-6-5-7-18-30-24(21-11-15-23(28)16-12-21)19-20-9-13-22(27)14-10-20/h9-16,24,27-28H,3-8,17-19H2,1-2H3.
What are the key properties of 6-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylhexanamide?
6-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylhexanamide has a molecular weight of 429.63 g/mol, XLogP of 5.93, 13 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1,2-bis(4-hydroxyphenyl)ethylsulfanyl]-N-butyl-N-methylhexanamide is sourced from PubChem (CID 10432801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).