C19H19ClF3N3O3 — CID 10432804
2-(6-chloro-1-oxo-4,9-dihydro-3H-pyrido[3,4-b]indol-2-yl)-N-(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)acetamide (PubChem CID 10432804) has the molecular formula C19H19ClF3N3O3 and a molecular weight of 429.83 g/mol. Its IUPAC name is 2-(6-chloro-1-oxo-4,9-dihydro-3H-pyrido[3,4-b]indol-2-yl)-N-(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)acetamide.
| Compound Name | 2-(6-chloro-1-oxo-4,9-dihydro-3H-pyrido[3,4-b]indol-2-yl)-N-(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)acetamide |
|---|---|
| PubChem CID | 10432804 |
| Molecular Formula | C19H19ClF3N3O3 |
| Molecular Weight | 429.83 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 2-(6-chloro-1-oxo-4,9-dihydro-3H-pyrido[3,4-b]indol-2-yl)-N-(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)acetamide |
| SMILES | CC(C)C(NC(=O)CN1CCc2c([nH]c3ccc(Cl)cc23)C1=O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C19H19ClF3N3O3/c1-9(2)15(17(28)19(21,22)23)25-14(27)8-26-6-5-11-12-7-10(20)3-4-13(12)24-16(11)18(26)29/h3-4,7,9,15,24H,5-6,8H2,1-2H3,(H,25,27) |
| InChIKey | LQDUUYPWLMAYCF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.83 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|