C25H35ClN2S — CID 10432878
1-benzyl-3-(decylsulfanylmethyl)benzimidazol-1-ium chloride (PubChem CID 10432878) has the molecular formula C25H35ClN2S and a molecular weight of 431.09 g/mol. Its IUPAC name is 1-benzyl-3-(decylsulfanylmethyl)benzimidazol-1-ium chloride.
| Compound Name | 1-benzyl-3-(decylsulfanylmethyl)benzimidazol-1-ium chloride |
|---|---|
| PubChem CID | 10432878 |
| Molecular Formula | C25H35ClN2S |
| Molecular Weight | 431.09 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 1-benzyl-3-(decylsulfanylmethyl)benzimidazol-1-ium chloride |
| SMILES | CCCCCCCCCCSCn1c[n+](Cc2ccccc2)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C25H35N2S.ClH/c1-2-3-4-5-6-7-8-14-19-28-22-27-21-26(20-23-15-10-9-11-16-23)24-17-12-13-18-25(24)27;/h9-13,15-18,21H,2-8,14,19-20,22H2,1H3;1H/q+1;/p-1 |
| InChIKey | YRLXATKEQATQCI-UHFFFAOYSA-M |
| XLogP | 3.81 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.09 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|