C20H17F5O3S — CID 10432932
ethyl 2-benzyl-2-methyl-3-oxo-4-(2,3,4,5,6-pentafluorophenyl)sulfanylbutanoate (PubChem CID 10432932) has the molecular formula C20H17F5O3S and a molecular weight of 432.41 g/mol. Its IUPAC name is ethyl 2-benzyl-2-methyl-3-oxo-4-(2,3,4,5,6-pentafluorophenyl)sulfanylbutanoate.
| Compound Name | ethyl 2-benzyl-2-methyl-3-oxo-4-(2,3,4,5,6-pentafluorophenyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 10432932 |
| Molecular Formula | C20H17F5O3S |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | ethyl 2-benzyl-2-methyl-3-oxo-4-(2,3,4,5,6-pentafluorophenyl)sulfanylbutanoate |
| SMILES | CCOC(=O)C(C)(Cc1ccccc1)C(=O)CSc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H17F5O3S/c1-3-28-19(27)20(2,9-11-7-5-4-6-8-11)12(26)10-29-18-16(24)14(22)13(21)15(23)17(18)25/h4-8H,3,9-10H2,1-2H3 |
| InChIKey | GTGVXOBXDAGYHJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|