C27H28O5 — CID 10432954
(3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-one (PubChem CID 10432954) has the molecular formula C27H28O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is (3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-one.
| Compound Name | (3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-one |
|---|---|
| PubChem CID | 10432954 |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-one |
| SMILES | C[C@@H]1OC(=O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H28O5/c1-20-24(29-17-21-11-5-2-6-12-21)25(30-18-22-13-7-3-8-14-22)26(27(28)32-20)31-19-23-15-9-4-10-16-23/h2-16,20,24-26H,17-19H2,1H3/t20-,24+,25+,26-/m0/s1 |
| InChIKey | SFKYGYRKFMUHAD-CCOBIDFTSA-N |
| XLogP | 4.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |