C25H25ClN4O — CID 10432980
1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]-2-pyridin-3-ylethanone (PubChem CID 10432980) has the molecular formula C25H25ClN4O and a molecular weight of 432.96 g/mol. Its IUPAC name is 1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 10432980 |
| Molecular Formula | C25H25ClN4O |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]-2-pyridin-3-ylethanone |
| SMILES | O=C(Cc1cccnc1)N1CCN(C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C25H25ClN4O/c26-21-7-8-22-20(16-21)6-5-19-4-2-10-28-24(19)25(22)30-13-11-29(12-14-30)23(31)15-18-3-1-9-27-17-18/h1-4,7-10,16-17,25H,5-6,11-15H2 |
| InChIKey | GZUAAANARRVXPY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |