About (5,5-dimethyl-1,3-dithian-2-yl)-dimethyl-phenylphosphanium
(5,5-dimethyl-1,3-dithian-2-yl)-dimethyl-phenylphosphanium (PubChem CID 10433061) has the molecular formula C14H22PS2+
and a molecular weight of 285.44 g/mol. Its IUPAC name is (5,5-dimethyl-1,3-dithian-2-yl)-dimethyl-phenylphosphanium.
Molecular Properties
| Compound Name | (5,5-dimethyl-1,3-dithian-2-yl)-dimethyl-phenylphosphanium |
| PubChem CID | 10433061 |
| Molecular Formula | C14H22PS2+ |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | (5,5-dimethyl-1,3-dithian-2-yl)-dimethyl-phenylphosphanium |
| SMILES | CC1(C)CSC([P+](C)(C)c2ccccc2)SC1 |
| InChI | InChI=1S/C14H22PS2/c1-14(2)10-16-13(17-11-14)15(3,4)12-8-6-5-7-9-12/h5-9,13H,10-11H2,1-4H3/q+1 |
| InChIKey | LMBGLGIGBXRDIG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (5,5-dimethyl-1,3-dithian-2-yl)-dimethyl-phenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,5-dimethyl-1,3-dithian-2-yl)-dimethyl-phenylphosphanium?
The IUPAC name of (5,5-dimethyl-1,3-dithian-2-yl)-dimethyl-phenylphosphanium (CID 10433061) is (5,5-dimethyl-1,3-dithian-2-yl)-dimethyl-phenylphosphanium.
What is the SMILES notation for (5,5-dimethyl-1,3-dithian-2-yl)-dimethyl-phenylphosphanium?
The canonical SMILES for (5,5-dimethyl-1,3-dithian-2-yl)-dimethyl-phenylphosphanium is CC1(C)CSC([P+](C)(C)c2ccccc2)SC1.
What is the InChIKey of (5,5-dimethyl-1,3-dithian-2-yl)-dimethyl-phenylphosphanium?
The InChIKey is LMBGLGIGBXRDIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22PS2/c1-14(2)10-16-13(17-11-14)15(3,4)12-8-6-5-7-9-12/h5-9,13H,10-11H2,1-4H3/q+1.
What are the key properties of (5,5-dimethyl-1,3-dithian-2-yl)-dimethyl-phenylphosphanium?
(5,5-dimethyl-1,3-dithian-2-yl)-dimethyl-phenylphosphanium has a molecular weight of 285.44 g/mol, XLogP of 4.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5,5-dimethyl-1,3-dithian-2-yl)-dimethyl-phenylphosphanium is sourced from PubChem (CID 10433061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).