C23H34N2O4S — CID 10433070
N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-N-methyldecanamide (PubChem CID 10433070) has the molecular formula C23H34N2O4S and a molecular weight of 434.60 g/mol. Its IUPAC name is N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-N-methyldecanamide.
| Compound Name | N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-N-methyldecanamide |
|---|---|
| PubChem CID | 10433070 |
| Molecular Formula | C23H34N2O4S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-N-methyldecanamide |
| SMILES | CCCCCCCCCC(=O)N(C)CCOc1ccc(CC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C23H34N2O4S/c1-3-4-5-6-7-8-9-10-21(26)25(2)15-16-29-19-13-11-18(12-14-19)17-20-22(27)24-23(28)30-20/h11-14,20H,3-10,15-17H2,1-2H3,(H,24,27,28) |
| InChIKey | NDFNNAKZGHJJMW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|