C25H19Cl2NO2 — CID 10433143
(E)-3-[1-[bis(4-chlorophenyl)methyl]indol-5-yl]but-2-enoic acid (PubChem CID 10433143) has the molecular formula C25H19Cl2NO2 and a molecular weight of 436.34 g/mol. Its IUPAC name is (E)-3-[1-[bis(4-chlorophenyl)methyl]indol-5-yl]but-2-enoic acid.
| Compound Name | (E)-3-[1-[bis(4-chlorophenyl)methyl]indol-5-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 10433143 |
| Molecular Formula | C25H19Cl2NO2 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | (E)-3-[1-[bis(4-chlorophenyl)methyl]indol-5-yl]but-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)c1ccc2c(ccn2C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C25H19Cl2NO2/c1-16(14-24(29)30)19-6-11-23-20(15-19)12-13-28(23)25(17-2-7-21(26)8-3-17)18-4-9-22(27)10-5-18/h2-15,25H,1H3,(H,29,30)/b16-14+ |
| InChIKey | KJXBMAHETFITGK-JQIJEIRASA-N |
| XLogP | 7.07 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|