C18H11BrClFN2O3 — CID 10433225
2-[(4-bromo-2-fluorophenyl)methyl]-5-chlorospiro[isoindole-3,3'-pyrrolidine]-1,2',5'-trione (PubChem CID 10433225) has the molecular formula C18H11BrClFN2O3 and a molecular weight of 437.65 g/mol. Its IUPAC name is 2-[(4-bromo-2-fluorophenyl)methyl]-5-chlorospiro[isoindole-3,3'-pyrrolidine]-1,2',5'-trione.
| Compound Name | 2-[(4-bromo-2-fluorophenyl)methyl]-5-chlorospiro[isoindole-3,3'-pyrrolidine]-1,2',5'-trione |
|---|---|
| PubChem CID | 10433225 |
| Molecular Formula | C18H11BrClFN2O3 |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | 2-[(4-bromo-2-fluorophenyl)methyl]-5-chlorospiro[isoindole-3,3'-pyrrolidine]-1,2',5'-trione |
| SMILES | O=C1CC2(C(=O)N1)c1cc(Cl)ccc1C(=O)N2Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C18H11BrClFN2O3/c19-10-2-1-9(14(21)5-10)8-23-16(25)12-4-3-11(20)6-13(12)18(23)7-15(24)22-17(18)26/h1-6H,7-8H2,(H,22,24,26) |
| InChIKey | BVZOQHDKUIMGGL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|