About 2-[4-(4,4-diphenylbutanoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile
2-[4-(4,4-diphenylbutanoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile (PubChem CID 10433272) has the molecular formula C28H30N4O
and a molecular weight of 438.58 g/mol. Its IUPAC name is 2-[4-(4,4-diphenylbutanoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile.
Molecular Properties
| Compound Name | 2-[4-(4,4-diphenylbutanoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile |
| PubChem CID | 10433272 |
| Molecular Formula | C28H30N4O |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 2-[4-(4,4-diphenylbutanoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile |
| SMILES | Cc1ncccc1C(C#N)N1CCN(C(=O)CCC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H30N4O/c1-22-25(13-8-16-30-22)27(21-29)31-17-19-32(20-18-31)28(33)15-14-26(23-9-4-2-5-10-23)24-11-6-3-7-12-24/h2-13,16,26-27H,14-15,17-20H2,1H3 |
| InChIKey | OGYVBYBGMVAIEE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(4,4-diphenylbutanoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4,4-diphenylbutanoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile?
The IUPAC name of 2-[4-(4,4-diphenylbutanoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile (CID 10433272) is 2-[4-(4,4-diphenylbutanoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile.
What is the SMILES notation for 2-[4-(4,4-diphenylbutanoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile?
The canonical SMILES for 2-[4-(4,4-diphenylbutanoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile is Cc1ncccc1C(C#N)N1CCN(C(=O)CCC(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of 2-[4-(4,4-diphenylbutanoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile?
The InChIKey is OGYVBYBGMVAIEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30N4O/c1-22-25(13-8-16-30-22)27(21-29)31-17-19-32(20-18-31)28(33)15-14-26(23-9-4-2-5-10-23)24-11-6-3-7-12-24/h2-13,16,26-27H,14-15,17-20H2,1H3.
What are the key properties of 2-[4-(4,4-diphenylbutanoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile?
2-[4-(4,4-diphenylbutanoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile has a molecular weight of 438.58 g/mol, XLogP of 4.71, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4,4-diphenylbutanoyl)piperazin-1-yl]-2-(2-methyl-3-pyridinyl)acetonitrile is sourced from PubChem (CID 10433272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).