C27H41NO2Si — CID 10433334
2-(1-benzylpiperidin-4-yl)-1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethanol (PubChem CID 10433334) has the molecular formula C27H41NO2Si and a molecular weight of 439.72 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-4-yl)-1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethanol.
| Compound Name | 2-(1-benzylpiperidin-4-yl)-1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethanol |
|---|---|
| PubChem CID | 10433334 |
| Molecular Formula | C27H41NO2Si |
| Molecular Weight | 439.72 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | 2-(1-benzylpiperidin-4-yl)-1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethanol |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(C(O)CC2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H41NO2Si/c1-27(2,3)31(4,5)30-21-24-11-13-25(14-12-24)26(29)19-22-15-17-28(18-16-22)20-23-9-7-6-8-10-23/h6-14,22,26,29H,15-21H2,1-5H3 |
| InChIKey | OCZWECPRBLZSHS-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.72 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|