About 1-[6-chloro-4-(4-methoxyphenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea
1-[6-chloro-4-(4-methoxyphenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea (PubChem CID 10433337) has the molecular formula C23H16ClF2N3O2
and a molecular weight of 439.85 g/mol. Its IUPAC name is 1-[6-chloro-4-(4-methoxyphenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea.
Molecular Properties
| Compound Name | 1-[6-chloro-4-(4-methoxyphenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea |
| PubChem CID | 10433337 |
| Molecular Formula | C23H16ClF2N3O2 |
| Molecular Weight | 439.85 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 1-[6-chloro-4-(4-methoxyphenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea |
| SMILES | COc1ccc(-c2c(NC(=O)Nc3ccc(F)cc3F)cnc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C23H16ClF2N3O2/c1-31-16-6-2-13(3-7-16)22-17-10-14(24)4-8-19(17)27-12-21(22)29-23(30)28-20-9-5-15(25)11-18(20)26/h2-12H,1H3,(H2,28,29,30) |
| InChIKey | VTABNCCHKYTPIF-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.85 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[6-chloro-4-(4-methoxyphenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-chloro-4-(4-methoxyphenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea?
The IUPAC name of 1-[6-chloro-4-(4-methoxyphenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea (CID 10433337) is 1-[6-chloro-4-(4-methoxyphenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea.
What is the SMILES notation for 1-[6-chloro-4-(4-methoxyphenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea?
The canonical SMILES for 1-[6-chloro-4-(4-methoxyphenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea is COc1ccc(-c2c(NC(=O)Nc3ccc(F)cc3F)cnc3ccc(Cl)cc23)cc1.
What is the InChIKey of 1-[6-chloro-4-(4-methoxyphenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea?
The InChIKey is VTABNCCHKYTPIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16ClF2N3O2/c1-31-16-6-2-13(3-7-16)22-17-10-14(24)4-8-19(17)27-12-21(22)29-23(30)28-20-9-5-15(25)11-18(20)26/h2-12H,1H3,(H2,28,29,30).
What are the key properties of 1-[6-chloro-4-(4-methoxyphenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea?
1-[6-chloro-4-(4-methoxyphenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea has a molecular weight of 439.85 g/mol, XLogP of 6.49, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-chloro-4-(4-methoxyphenyl)quinolin-3-yl]-3-(2,4-difluorophenyl)urea is sourced from PubChem (CID 10433337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).