C18H14F6O2S2 — CID 10433361
1-[(1R,4R)-1,2,2,3,3,4-hexafluoro-4-(4-methylsulfinylphenyl)cyclobutyl]-4-methylsulfinylbenzene (PubChem CID 10433361) has the molecular formula C18H14F6O2S2 and a molecular weight of 440.43 g/mol. Its IUPAC name is 1-[(1R,4R)-1,2,2,3,3,4-hexafluoro-4-(4-methylsulfinylphenyl)cyclobutyl]-4-methylsulfinylbenzene.
| Compound Name | 1-[(1R,4R)-1,2,2,3,3,4-hexafluoro-4-(4-methylsulfinylphenyl)cyclobutyl]-4-methylsulfinylbenzene |
|---|---|
| PubChem CID | 10433361 |
| Molecular Formula | C18H14F6O2S2 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 1-[(1R,4R)-1,2,2,3,3,4-hexafluoro-4-(4-methylsulfinylphenyl)cyclobutyl]-4-methylsulfinylbenzene |
| SMILES | CS(=O)c1ccc([C@]2(F)C(F)(F)C(F)(F)[C@@]2(F)c2ccc(S(C)=O)cc2)cc1 |
| InChI | InChI=1S/C18H14F6O2S2/c1-27(25)13-7-3-11(4-8-13)15(19)16(20,18(23,24)17(15,21)22)12-5-9-14(10-6-12)28(2)26/h3-10H,1-2H3/t15-,16-,27?,28?/m1/s1 |
| InChIKey | MWGLLFLKYRPQBU-OBIRYBJYSA-N |
| XLogP | 4.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|