C25H23N5O3 — CID 10433417
6-[[2-[4-(6-methoxy-1,5-naphthyridin-4-yl)phenyl]ethylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 10433417) has the molecular formula C25H23N5O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is 6-[[2-[4-(6-methoxy-1,5-naphthyridin-4-yl)phenyl]ethylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-[[2-[4-(6-methoxy-1,5-naphthyridin-4-yl)phenyl]ethylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 10433417 |
| Molecular Formula | C25H23N5O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 6-[[2-[4-(6-methoxy-1,5-naphthyridin-4-yl)phenyl]ethylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | COc1ccc2nccc(-c3ccc(CCNCc4ccc5c(n4)NC(=O)CO5)cc3)c2n1 |
| InChI | InChI=1S/C25H23N5O3/c1-32-23-9-7-20-24(30-23)19(11-13-27-20)17-4-2-16(3-5-17)10-12-26-14-18-6-8-21-25(28-18)29-22(31)15-33-21/h2-9,11,13,26H,10,12,14-15H2,1H3,(H,28,29,31) |
| InChIKey | VSHISEMBWAZGSV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|