C21H28F2N2O4S — CID 10433465
2-[4-[(5S)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-methyl-2-oxoimidazolidin-1-yl]butylsulfanyl]propanoic acid (PubChem CID 10433465) has the molecular formula C21H28F2N2O4S and a molecular weight of 442.53 g/mol. Its IUPAC name is 2-[4-[(5S)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-methyl-2-oxoimidazolidin-1-yl]butylsulfanyl]propanoic acid.
| Compound Name | 2-[4-[(5S)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-methyl-2-oxoimidazolidin-1-yl]butylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 10433465 |
| Molecular Formula | C21H28F2N2O4S |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 2-[4-[(5S)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-3-methyl-2-oxoimidazolidin-1-yl]butylsulfanyl]propanoic acid |
| SMILES | CC(SCCCCN1C(=O)N(C)C[C@@H]1/C=C/C(O)C(F)(F)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H28F2N2O4S/c1-15(19(27)28)30-13-7-6-12-25-17(14-24(2)20(25)29)10-11-18(26)21(22,23)16-8-4-3-5-9-16/h3-5,8-11,15,17-18,26H,6-7,12-14H2,1-2H3,(H,27,28)/b11-10+/t15?,17-,18?/m0/s1 |
| InChIKey | XWHNZFSBIVCIRW-KNZMGLHZSA-N |
| XLogP | 3.42 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|