C24H26O6S — CID 10433466
1-O-benzyl 2-O-methyl (1S,2S,6R)-6-methoxy-1-[(S)-(4-methylphenyl)sulfinyl]cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 10433466) has the molecular formula C24H26O6S and a molecular weight of 442.53 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (1S,2S,6R)-6-methoxy-1-[(S)-(4-methylphenyl)sulfinyl]cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (1S,2S,6R)-6-methoxy-1-[(S)-(4-methylphenyl)sulfinyl]cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10433466 |
| Molecular Formula | C24H26O6S |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (1S,2S,6R)-6-methoxy-1-[(S)-(4-methylphenyl)sulfinyl]cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC=C[C@@H](OC)[C@@]1(C(=O)OCc1ccccc1)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H26O6S/c1-17-12-14-19(15-13-17)31(27)24(23(26)30-16-18-8-5-4-6-9-18)20(22(25)29-3)10-7-11-21(24)28-2/h4-9,11-15,20-21H,10,16H2,1-3H3/t20-,21+,24-,31-/m0/s1 |
| InChIKey | XTTPWFHKAANYJW-CTPRRDHXSA-N |
| XLogP | 3.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|