C19H33N5O7 — CID 10433512
(2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]pentanoyl]amino]-3-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid (PubChem CID 10433512) has the molecular formula C19H33N5O7 and a molecular weight of 443.50 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]pentanoyl]amino]-3-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]pentanoyl]amino]-3-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10433512 |
| Molecular Formula | C19H33N5O7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]pentanoyl]amino]-3-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]propanoic acid |
| SMILES | CCC[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CNC(=O)/C=C/C(=O)OC)C(=O)O |
| InChI | InChI=1S/C19H33N5O7/c1-3-6-13(23-17(27)12(21)7-4-5-10-20)18(28)24-14(19(29)30)11-22-15(25)8-9-16(26)31-2/h8-9,12-14H,3-7,10-11,20-21H2,1-2H3,(H,22,25)(H,23,27)(H,24,28)(H,29,30)/b9-8+/t12-,13-,14-/m0/s1 |
| InChIKey | WNEPNOVMWKMIOG-GRZPXJOKSA-N |
| XLogP | -1.86 |
| TPSA | 202.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|