About 1,3-bis(4-butan-2-ylphenyl)-1,3-diazinan-2-imine
1,3-bis(4-butan-2-ylphenyl)-1,3-diazinan-2-imine (PubChem CID 10433574) has the molecular formula C24H33N3
and a molecular weight of 363.55 g/mol. Its IUPAC name is 1,3-bis(4-butan-2-ylphenyl)-1,3-diazinan-2-imine.
Molecular Properties
| Compound Name | 1,3-bis(4-butan-2-ylphenyl)-1,3-diazinan-2-imine |
| PubChem CID | 10433574 |
| Molecular Formula | C24H33N3 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.27 |
| IUPAC Name | 1,3-bis(4-butan-2-ylphenyl)-1,3-diazinan-2-imine |
| SMILES | [H]N=C1N(c2ccc(C(C)CC)cc2)CCCN1c1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C24H33N3/c1-5-18(3)20-8-12-22(13-9-20)26-16-7-17-27(24(26)25)23-14-10-21(11-15-23)19(4)6-2/h8-15,18-19,25H,5-7,16-17H2,1-4H3 |
| InChIKey | PUGLCELYQWRJRC-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(4-butan-2-ylphenyl)-1,3-diazinan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(4-butan-2-ylphenyl)-1,3-diazinan-2-imine?
The IUPAC name of 1,3-bis(4-butan-2-ylphenyl)-1,3-diazinan-2-imine (CID 10433574) is 1,3-bis(4-butan-2-ylphenyl)-1,3-diazinan-2-imine.
What is the SMILES notation for 1,3-bis(4-butan-2-ylphenyl)-1,3-diazinan-2-imine?
The canonical SMILES for 1,3-bis(4-butan-2-ylphenyl)-1,3-diazinan-2-imine is [H]N=C1N(c2ccc(C(C)CC)cc2)CCCN1c1ccc(C(C)CC)cc1.
What is the InChIKey of 1,3-bis(4-butan-2-ylphenyl)-1,3-diazinan-2-imine?
The InChIKey is PUGLCELYQWRJRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33N3/c1-5-18(3)20-8-12-22(13-9-20)26-16-7-17-27(24(26)25)23-14-10-21(11-15-23)19(4)6-2/h8-15,18-19,25H,5-7,16-17H2,1-4H3.
What are the key properties of 1,3-bis(4-butan-2-ylphenyl)-1,3-diazinan-2-imine?
1,3-bis(4-butan-2-ylphenyl)-1,3-diazinan-2-imine has a molecular weight of 363.55 g/mol, XLogP of 6.37, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(4-butan-2-ylphenyl)-1,3-diazinan-2-imine is sourced from PubChem (CID 10433574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).