C23H15N3O7 — CID 10433632
methyl 6-[13-(2-hydroxyethyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]pyridine-3-carboxylate (PubChem CID 10433632) has the molecular formula C23H15N3O7 and a molecular weight of 445.39 g/mol. Its IUPAC name is methyl 6-[13-(2-hydroxyethyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[13-(2-hydroxyethyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10433632 |
| Molecular Formula | C23H15N3O7 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | methyl 6-[13-(2-hydroxyethyl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(CCO)C4=O)nc1 |
| InChI | InChI=1S/C23H15N3O7/c1-33-23(32)11-2-7-16(24-10-11)26-21(30)14-5-3-12-17-13(4-6-15(18(14)17)22(26)31)20(29)25(8-9-27)19(12)28/h2-7,10,27H,8-9H2,1H3 |
| InChIKey | AKFWKEBYEPFNJV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 134.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|