C29H35NO3 — CID 10433660
[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-2-benzamido-2-methylpent-4-ynoate (PubChem CID 10433660) has the molecular formula C29H35NO3 and a molecular weight of 445.60 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-2-benzamido-2-methylpent-4-ynoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-2-benzamido-2-methylpent-4-ynoate |
|---|---|
| PubChem CID | 10433660 |
| Molecular Formula | C29H35NO3 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2S)-2-benzamido-2-methylpent-4-ynoate |
| SMILES | C#CC[C@](C)(NC(=O)c1ccccc1)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C29H35NO3/c1-6-19-29(5,30-26(31)22-13-9-7-10-14-22)27(32)33-25-20-21(2)17-18-24(25)28(3,4)23-15-11-8-12-16-23/h1,7-16,21,24-25H,17-20H2,2-5H3,(H,30,31)/t21-,24-,25-,29+/m1/s1 |
| InChIKey | UIFGKRIVTXKPIQ-NFCHJMJDSA-N |
| XLogP | 5.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|