C21H17F5N4O2 — CID 10434000
[(4R,5R)-5-(2,4-difluorophenyl)-4-methyl-5-(1,2,4-triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 10434000) has the molecular formula C21H17F5N4O2 and a molecular weight of 452.38 g/mol. Its IUPAC name is [(4R,5R)-5-(2,4-difluorophenyl)-4-methyl-5-(1,2,4-triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(4R,5R)-5-(2,4-difluorophenyl)-4-methyl-5-(1,2,4-triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 10434000 |
| Molecular Formula | C21H17F5N4O2 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | [(4R,5R)-5-(2,4-difluorophenyl)-4-methyl-5-(1,2,4-triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | C[C@H]1N(C(=O)c2ccc(C(F)(F)F)cc2)CO[C@@]1(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H17F5N4O2/c1-13-20(9-29-11-27-10-28-29,17-7-6-16(22)8-18(17)23)32-12-30(13)19(31)14-2-4-15(5-3-14)21(24,25)26/h2-8,10-11,13H,9,12H2,1H3/t13-,20-/m1/s1 |
| InChIKey | KMVBFZQAKGZIMA-ZUOKHONESA-N |
| XLogP | 3.99 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |