About [4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-[2-(2-hydroxyethyl)piperidin-1-yl]methanone
[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-[2-(2-hydroxyethyl)piperidin-1-yl]methanone (PubChem CID 10434025) has the molecular formula C25H28N2O4S
and a molecular weight of 452.58 g/mol. Its IUPAC name is [4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-[2-(2-hydroxyethyl)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | [4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-[2-(2-hydroxyethyl)piperidin-1-yl]methanone |
| PubChem CID | 10434025 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-[2-(2-hydroxyethyl)piperidin-1-yl]methanone |
| SMILES | COc1ccc(-c2nc(C(=O)N3CCCCC3CCO)sc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H28N2O4S/c1-30-20-10-6-17(7-11-20)22-23(18-8-12-21(31-2)13-9-18)32-24(26-22)25(29)27-15-4-3-5-19(27)14-16-28/h6-13,19,28H,3-5,14-16H2,1-2H3 |
| InChIKey | PZLTTZCXVKXRSW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-[2-(2-hydroxyethyl)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-[2-(2-hydroxyethyl)piperidin-1-yl]methanone?
The IUPAC name of [4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-[2-(2-hydroxyethyl)piperidin-1-yl]methanone (CID 10434025) is [4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-[2-(2-hydroxyethyl)piperidin-1-yl]methanone.
What is the SMILES notation for [4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-[2-(2-hydroxyethyl)piperidin-1-yl]methanone?
The canonical SMILES for [4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-[2-(2-hydroxyethyl)piperidin-1-yl]methanone is COc1ccc(-c2nc(C(=O)N3CCCCC3CCO)sc2-c2ccc(OC)cc2)cc1.
What is the InChIKey of [4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-[2-(2-hydroxyethyl)piperidin-1-yl]methanone?
The InChIKey is PZLTTZCXVKXRSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N2O4S/c1-30-20-10-6-17(7-11-20)22-23(18-8-12-21(31-2)13-9-18)32-24(26-22)25(29)27-15-4-3-5-19(27)14-16-28/h6-13,19,28H,3-5,14-16H2,1-2H3.
What are the key properties of [4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-[2-(2-hydroxyethyl)piperidin-1-yl]methanone?
[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-[2-(2-hydroxyethyl)piperidin-1-yl]methanone has a molecular weight of 452.58 g/mol, XLogP of 4.87, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-[2-(2-hydroxyethyl)piperidin-1-yl]methanone is sourced from PubChem (CID 10434025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).