About 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfinyl]-2,6-difluorophenoxy]acetic acid
2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfinyl]-2,6-difluorophenoxy]acetic acid (PubChem CID 10434087) has the molecular formula C16H14ClF2NO6S2
and a molecular weight of 453.87 g/mol. Its IUPAC name is 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfinyl]-2,6-difluorophenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfinyl]-2,6-difluorophenoxy]acetic acid |
| PubChem CID | 10434087 |
| Molecular Formula | C16H14ClF2NO6S2 |
| Molecular Weight | 453.87 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfinyl]-2,6-difluorophenoxy]acetic acid |
| SMILES | O=C(O)COc1c(F)cc(S(=O)CCNS(=O)(=O)c2ccc(Cl)cc2)cc1F |
| InChI | InChI=1S/C16H14ClF2NO6S2/c17-10-1-3-12(4-2-10)28(24,25)20-5-6-27(23)11-7-13(18)16(14(19)8-11)26-9-15(21)22/h1-4,7-8,20H,5-6,9H2,(H,21,22) |
| InChIKey | MISKQWYLWKXYRM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.87 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfinyl]-2,6-difluorophenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfinyl]-2,6-difluorophenoxy]acetic acid?
The IUPAC name of 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfinyl]-2,6-difluorophenoxy]acetic acid (CID 10434087) is 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfinyl]-2,6-difluorophenoxy]acetic acid.
What is the SMILES notation for 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfinyl]-2,6-difluorophenoxy]acetic acid?
The canonical SMILES for 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfinyl]-2,6-difluorophenoxy]acetic acid is O=C(O)COc1c(F)cc(S(=O)CCNS(=O)(=O)c2ccc(Cl)cc2)cc1F.
What is the InChIKey of 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfinyl]-2,6-difluorophenoxy]acetic acid?
The InChIKey is MISKQWYLWKXYRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClF2NO6S2/c17-10-1-3-12(4-2-10)28(24,25)20-5-6-27(23)11-7-13(18)16(14(19)8-11)26-9-15(21)22/h1-4,7-8,20H,5-6,9H2,(H,21,22).
What are the key properties of 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfinyl]-2,6-difluorophenoxy]acetic acid?
2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfinyl]-2,6-difluorophenoxy]acetic acid has a molecular weight of 453.87 g/mol, XLogP of 2.17, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-[(4-chlorophenyl)sulfonylamino]ethylsulfinyl]-2,6-difluorophenoxy]acetic acid is sourced from PubChem (CID 10434087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).