C28H40O5 — CID 10434219
methyl (1R,11S,15R,16R,21R)-16,21-dihydroxy-1,11,15,19,19-pentamethyl-10-oxapentacyclo[12.8.0.02,11.04,9.015,20]docosa-4(9),5,7-triene-6-carboxylate (PubChem CID 10434219) has the molecular formula C28H40O5 and a molecular weight of 456.62 g/mol. Its IUPAC name is methyl (1R,11S,15R,16R,21R)-16,21-dihydroxy-1,11,15,19,19-pentamethyl-10-oxapentacyclo[12.8.0.02,11.04,9.015,20]docosa-4(9),5,7-triene-6-carboxylate.
| Compound Name | methyl (1R,11S,15R,16R,21R)-16,21-dihydroxy-1,11,15,19,19-pentamethyl-10-oxapentacyclo[12.8.0.02,11.04,9.015,20]docosa-4(9),5,7-triene-6-carboxylate |
|---|---|
| PubChem CID | 10434219 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | methyl (1R,11S,15R,16R,21R)-16,21-dihydroxy-1,11,15,19,19-pentamethyl-10-oxapentacyclo[12.8.0.02,11.04,9.015,20]docosa-4(9),5,7-triene-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CC1[C@]3(C)C[C@@H](O)C4C(C)(C)CC[C@@H](O)[C@]4(C)C3CC[C@]1(C)O2 |
| InChI | InChI=1S/C28H40O5/c1-25(2)11-10-22(30)28(5)20-9-12-27(4)21(26(20,3)15-18(29)23(25)28)14-17-13-16(24(31)32-6)7-8-19(17)33-27/h7-8,13,18,20-23,29-30H,9-12,14-15H2,1-6H3/t18-,20?,21?,22-,23?,26-,27+,28+/m1/s1 |
| InChIKey | NQNQLGPYASRQND-AGJVNAMPSA-N |
| XLogP | 4.77 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |