C29H48O4 — CID 10434410
1-[(1R,2S,5R,6R,7S,9R,10S,11S,13R)-7-hydroxy-10-(3-hydroxypropyl)-2,6,9-trimethyl-5-[(2R)-6-methylhept-5-en-2-yl]-12-oxatetracyclo[7.5.0.02,6.011,13]tetradecan-11-yl]ethanone (PubChem CID 10434410) has the molecular formula C29H48O4 and a molecular weight of 460.70 g/mol. Its IUPAC name is 1-[(1R,2S,5R,6R,7S,9R,10S,11S,13R)-7-hydroxy-10-(3-hydroxypropyl)-2,6,9-trimethyl-5-[(2R)-6-methylhept-5-en-2-yl]-12-oxatetracyclo[7.5.0.02,6.011,13]tetradecan-11-yl]ethanone.
| Compound Name | 1-[(1R,2S,5R,6R,7S,9R,10S,11S,13R)-7-hydroxy-10-(3-hydroxypropyl)-2,6,9-trimethyl-5-[(2R)-6-methylhept-5-en-2-yl]-12-oxatetracyclo[7.5.0.02,6.011,13]tetradecan-11-yl]ethanone |
|---|---|
| PubChem CID | 10434410 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | 1-[(1R,2S,5R,6R,7S,9R,10S,11S,13R)-7-hydroxy-10-(3-hydroxypropyl)-2,6,9-trimethyl-5-[(2R)-6-methylhept-5-en-2-yl]-12-oxatetracyclo[7.5.0.02,6.011,13]tetradecan-11-yl]ethanone |
| SMILES | CC(=O)[C@@]12O[C@@H]1C[C@@H]1[C@@](C)(C[C@H](O)[C@]3(C)[C@@H]([C@H](C)CCC=C(C)C)CC[C@@]13C)[C@@H]2CCCO |
| InChI | InChI=1S/C29H48O4/c1-18(2)10-8-11-19(3)21-13-14-27(6)23-16-25-29(33-25,20(4)31)22(12-9-15-30)26(23,5)17-24(32)28(21,27)7/h10,19,21-25,30,32H,8-9,11-17H2,1-7H3/t19-,21-,22+,23-,24+,25-,26+,27+,28+,29+/m1/s1 |
| InChIKey | DXYFXQLAQAPBFS-JJSILCOISA-N |
| XLogP | 5.70 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|