About bis(2,3-dihydroxybutanedioic acid);3-(1-methylpyrrolidin-2-yl)pyridine
bis(2,3-dihydroxybutanedioic acid);3-(1-methylpyrrolidin-2-yl)pyridine (PubChem CID 10434468) has the molecular formula C18H26N2O12
and a molecular weight of 462.41 g/mol. Its IUPAC name is bis(2,3-dihydroxybutanedioic acid);3-(1-methylpyrrolidin-2-yl)pyridine.
Molecular Properties
| Compound Name | bis(2,3-dihydroxybutanedioic acid);3-(1-methylpyrrolidin-2-yl)pyridine |
| PubChem CID | 10434468 |
| Molecular Formula | C18H26N2O12 |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | bis(2,3-dihydroxybutanedioic acid);3-(1-methylpyrrolidin-2-yl)pyridine |
| SMILES | CN1CCCC1c1cccnc1.O=C(O)C(O)C(O)C(=O)O.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C10H14N2.2C4H6O6/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;2*5-1(3(7)8)2(6)4(9)10/h2,4,6,8,10H,3,5,7H2,1H3;2*1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | RFEJUZJILGIRHQ-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 246.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze bis(2,3-dihydroxybutanedioic acid);3-(1-methylpyrrolidin-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,3-dihydroxybutanedioic acid);3-(1-methylpyrrolidin-2-yl)pyridine?
The IUPAC name of bis(2,3-dihydroxybutanedioic acid);3-(1-methylpyrrolidin-2-yl)pyridine (CID 10434468) is bis(2,3-dihydroxybutanedioic acid);3-(1-methylpyrrolidin-2-yl)pyridine.
What is the SMILES notation for bis(2,3-dihydroxybutanedioic acid);3-(1-methylpyrrolidin-2-yl)pyridine?
The canonical SMILES for bis(2,3-dihydroxybutanedioic acid);3-(1-methylpyrrolidin-2-yl)pyridine is CN1CCCC1c1cccnc1.O=C(O)C(O)C(O)C(=O)O.O=C(O)C(O)C(O)C(=O)O.
What is the InChIKey of bis(2,3-dihydroxybutanedioic acid);3-(1-methylpyrrolidin-2-yl)pyridine?
The InChIKey is RFEJUZJILGIRHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.2C4H6O6/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;2*5-1(3(7)8)2(6)4(9)10/h2,4,6,8,10H,3,5,7H2,1H3;2*1-2,5-6H,(H,7,8)(H,9,10).
What are the key properties of bis(2,3-dihydroxybutanedioic acid);3-(1-methylpyrrolidin-2-yl)pyridine?
bis(2,3-dihydroxybutanedioic acid);3-(1-methylpyrrolidin-2-yl)pyridine has a molecular weight of 462.41 g/mol, XLogP of -2.40, 7 rotatable bonds, 8 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,3-dihydroxybutanedioic acid);3-(1-methylpyrrolidin-2-yl)pyridine is sourced from PubChem (CID 10434468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).