C26H24ClFN4O — CID 10434512
3-(2-chlorophenyl)-6-fluoro-2-[[3-(pyrrolidin-1-ylmethyl)anilino]methyl]quinazolin-4-one (PubChem CID 10434512) has the molecular formula C26H24ClFN4O and a molecular weight of 462.96 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-6-fluoro-2-[[3-(pyrrolidin-1-ylmethyl)anilino]methyl]quinazolin-4-one.
| Compound Name | 3-(2-chlorophenyl)-6-fluoro-2-[[3-(pyrrolidin-1-ylmethyl)anilino]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 10434512 |
| Molecular Formula | C26H24ClFN4O |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 3-(2-chlorophenyl)-6-fluoro-2-[[3-(pyrrolidin-1-ylmethyl)anilino]methyl]quinazolin-4-one |
| SMILES | O=c1c2cc(F)ccc2nc(CNc2cccc(CN3CCCC3)c2)n1-c1ccccc1Cl |
| InChI | InChI=1S/C26H24ClFN4O/c27-22-8-1-2-9-24(22)32-25(30-23-11-10-19(28)15-21(23)26(32)33)16-29-20-7-5-6-18(14-20)17-31-12-3-4-13-31/h1-2,5-11,14-15,29H,3-4,12-13,16-17H2 |
| InChIKey | ADZWRNLELCYOIA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |