About 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]acetamide
2-(2,4-dibromo-6-methoxyphenoxy)-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]acetamide (PubChem CID 1043453) has the molecular formula C18H15Br2N3O4
and a molecular weight of 497.14 g/mol. Its IUPAC name is 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]acetamide.
Molecular Properties
| Compound Name | 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]acetamide |
| PubChem CID | 1043453 |
| Molecular Formula | C18H15Br2N3O4 |
| Molecular Weight | 497.14 g/mol |
| Exact Mass | 494.94 |
| IUPAC Name | 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]acetamide |
| SMILES | COc1cc(Br)cc(Br)c1OCC(=O)/N=N/c1c(O)[nH]c2ccc(C)cc12 |
| InChI | InChI=1S/C18H15Br2N3O4/c1-9-3-4-13-11(5-9)16(18(25)21-13)23-22-15(24)8-27-17-12(20)6-10(19)7-14(17)26-2/h3-7,21,25H,8H2,1-2H3/b23-22+ |
| InChIKey | NUSWXYOIZRNYJU-GHVJWSGMSA-N |
| XLogP | 5.40 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.14 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]acetamide?
The IUPAC name of 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]acetamide (CID 1043453) is 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]acetamide.
What is the SMILES notation for 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]acetamide?
The canonical SMILES for 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]acetamide is COc1cc(Br)cc(Br)c1OCC(=O)/N=N/c1c(O)[nH]c2ccc(C)cc12.
What is the InChIKey of 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]acetamide?
The InChIKey is NUSWXYOIZRNYJU-GHVJWSGMSA-N. The full InChI is InChI=1S/C18H15Br2N3O4/c1-9-3-4-13-11(5-9)16(18(25)21-13)23-22-15(24)8-27-17-12(20)6-10(19)7-14(17)26-2/h3-7,21,25H,8H2,1-2H3/b23-22+.
What are the key properties of 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]acetamide?
2-(2,4-dibromo-6-methoxyphenoxy)-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]acetamide has a molecular weight of 497.14 g/mol, XLogP of 5.40, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dibromo-6-methoxyphenoxy)-N-[(2-hydroxy-5-methyl-1H-indol-3-yl)imino]acetamide is sourced from PubChem (CID 1043453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).