C28H32N6O — CID 10434792
7-[[6-(1-ethanimidoylpiperidin-4-yl)oxy-2-ethylbenzimidazol-1-yl]methyl]naphthalene-2-carboximidamide (PubChem CID 10434792) has the molecular formula C28H32N6O and a molecular weight of 468.61 g/mol. Its IUPAC name is 7-[[6-(1-ethanimidoylpiperidin-4-yl)oxy-2-ethylbenzimidazol-1-yl]methyl]naphthalene-2-carboximidamide.
| Compound Name | 7-[[6-(1-ethanimidoylpiperidin-4-yl)oxy-2-ethylbenzimidazol-1-yl]methyl]naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 10434792 |
| Molecular Formula | C28H32N6O |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 7-[[6-(1-ethanimidoylpiperidin-4-yl)oxy-2-ethylbenzimidazol-1-yl]methyl]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2ccc(Cn3c(CC)nc4ccc(OC5CCN(/C(C)=N/[H])CC5)cc43)cc2c1 |
| InChI | InChI=1S/C28H32N6O/c1-3-27-32-25-9-8-24(35-23-10-12-33(13-11-23)18(2)29)16-26(25)34(27)17-19-4-5-20-6-7-21(28(30)31)15-22(20)14-19/h4-9,14-16,23,29H,3,10-13,17H2,1-2H3,(H3,30,31)/b29-18+ |
| InChIKey | RFEXMZCPQGEUSL-RDRPBHBLSA-N |
| XLogP | 4.92 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|