C24H36N2O4S2 — CID 10435297
N-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide (PubChem CID 10435297) has the molecular formula C24H36N2O4S2 and a molecular weight of 480.70 g/mol. Its IUPAC name is N-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide.
| Compound Name | N-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide |
|---|---|
| PubChem CID | 10435297 |
| Molecular Formula | C24H36N2O4S2 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | N-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]-6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxamide |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(C(=O)NCCNC(=O)CCCCC1CCSS1)O2 |
| InChI | InChI=1S/C24H36N2O4S2/c1-15-16(2)22-19(17(3)21(15)28)9-11-24(4,30-22)23(29)26-13-12-25-20(27)8-6-5-7-18-10-14-31-32-18/h18,28H,5-14H2,1-4H3,(H,25,27)(H,26,29) |
| InChIKey | NEBNYACSMLWNQA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|