C23H25F3N2O4S — CID 10435359
N-(cyanomethyl)-4-methyl-2-[2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethoxy]pentanamide (PubChem CID 10435359) has the molecular formula C23H25F3N2O4S and a molecular weight of 482.52 g/mol. Its IUPAC name is N-(cyanomethyl)-4-methyl-2-[2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethoxy]pentanamide.
| Compound Name | N-(cyanomethyl)-4-methyl-2-[2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethoxy]pentanamide |
|---|---|
| PubChem CID | 10435359 |
| Molecular Formula | C23H25F3N2O4S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | N-(cyanomethyl)-4-methyl-2-[2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethoxy]pentanamide |
| SMILES | CC(C)CC(OC(c1ccc(-c2ccc(S(C)(=O)=O)cc2)cc1)C(F)(F)F)C(=O)NCC#N |
| InChI | InChI=1S/C23H25F3N2O4S/c1-15(2)14-20(22(29)28-13-12-27)32-21(23(24,25)26)18-6-4-16(5-7-18)17-8-10-19(11-9-17)33(3,30)31/h4-11,15,20-21H,13-14H2,1-3H3,(H,28,29) |
| InChIKey | ZKBFDCIZYJQUCQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|