C16H16Br2N4O4 — CID 10435576
2,7-bis(bromomethyl)-5,10-dimethoxy-3,8-dimethylpyrimido[4,5-g]quinazoline-4,9-dione (PubChem CID 10435576) has the molecular formula C16H16Br2N4O4 and a molecular weight of 488.14 g/mol. Its IUPAC name is 2,7-bis(bromomethyl)-5,10-dimethoxy-3,8-dimethylpyrimido[4,5-g]quinazoline-4,9-dione.
| Compound Name | 2,7-bis(bromomethyl)-5,10-dimethoxy-3,8-dimethylpyrimido[4,5-g]quinazoline-4,9-dione |
|---|---|
| PubChem CID | 10435576 |
| Molecular Formula | C16H16Br2N4O4 |
| Molecular Weight | 488.14 g/mol |
| Exact Mass | 485.95 |
| IUPAC Name | 2,7-bis(bromomethyl)-5,10-dimethoxy-3,8-dimethylpyrimido[4,5-g]quinazoline-4,9-dione |
| SMILES | COc1c2nc(CBr)n(C)c(=O)c2c(OC)c2nc(CBr)n(C)c(=O)c12 |
| InChI | InChI=1S/C16H16Br2N4O4/c1-21-7(5-17)19-11-9(15(21)23)13(25-3)12-10(14(11)26-4)16(24)22(2)8(6-18)20-12/h5-6H2,1-4H3 |
| InChIKey | OAIDJPDDUYAYTI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.14 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|