C20H20ClN7O4S — CID 10435656
N'-(5-chloro-2-pyridinyl)-N-[(2S)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-2-carbonyl)amino]-2-(1,3-oxazol-5-yl)ethyl]oxamide (PubChem CID 10435656) has the molecular formula C20H20ClN7O4S and a molecular weight of 489.95 g/mol. Its IUPAC name is N'-(5-chloro-2-pyridinyl)-N-[(2S)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-2-carbonyl)amino]-2-(1,3-oxazol-5-yl)ethyl]oxamide.
| Compound Name | N'-(5-chloro-2-pyridinyl)-N-[(2S)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-2-carbonyl)amino]-2-(1,3-oxazol-5-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 10435656 |
| Molecular Formula | C20H20ClN7O4S |
| Molecular Weight | 489.95 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | N'-(5-chloro-2-pyridinyl)-N-[(2S)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine-2-carbonyl)amino]-2-(1,3-oxazol-5-yl)ethyl]oxamide |
| SMILES | CN1CCc2sc(C(=O)N[C@@H](CNC(=O)C(=O)Nc3ccc(Cl)cn3)c3cnco3)nc2C1 |
| InChI | InChI=1S/C20H20ClN7O4S/c1-28-5-4-15-13(9-28)26-20(33-15)19(31)25-12(14-8-22-10-32-14)7-24-17(29)18(30)27-16-3-2-11(21)6-23-16/h2-3,6,8,10,12H,4-5,7,9H2,1H3,(H,24,29)(H,25,31)(H,23,27,30)/t12-/m0/s1 |
| InChIKey | DMLAALXKCWZIQX-LBPRGKRZSA-N |
| XLogP | 1.39 |
| TPSA | 142.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.95 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|