C21H11ClF4N4O4 — CID 10435858
1-[3-chloro-4-[(2-cyano-4-pyridinyl)oxy]phenyl]-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)urea (PubChem CID 10435858) has the molecular formula C21H11ClF4N4O4 and a molecular weight of 494.79 g/mol. Its IUPAC name is 1-[3-chloro-4-[(2-cyano-4-pyridinyl)oxy]phenyl]-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)urea.
| Compound Name | 1-[3-chloro-4-[(2-cyano-4-pyridinyl)oxy]phenyl]-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)urea |
|---|---|
| PubChem CID | 10435858 |
| Molecular Formula | C21H11ClF4N4O4 |
| Molecular Weight | 494.79 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | 1-[3-chloro-4-[(2-cyano-4-pyridinyl)oxy]phenyl]-3-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)urea |
| SMILES | N#Cc1cc(Oc2ccc(NC(=O)Nc3ccc4c(c3)OC(F)(F)C(F)(F)O4)cc2Cl)ccn1 |
| InChI | InChI=1S/C21H11ClF4N4O4/c22-15-8-11(1-3-16(15)32-14-5-6-28-13(7-14)10-27)29-19(31)30-12-2-4-17-18(9-12)34-21(25,26)20(23,24)33-17/h1-9H,(H2,29,30,31) |
| InChIKey | HJACLYZBYZTBOL-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.79 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|