C30H44O4S — CID 10436064
2-[(3E,7E,11E)-5-(benzenesulfonyl)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]-1,3-dioxolane (PubChem CID 10436064) has the molecular formula C30H44O4S and a molecular weight of 500.75 g/mol. Its IUPAC name is 2-[(3E,7E,11E)-5-(benzenesulfonyl)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]-1,3-dioxolane.
| Compound Name | 2-[(3E,7E,11E)-5-(benzenesulfonyl)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 10436064 |
| Molecular Formula | C30H44O4S |
| Molecular Weight | 500.75 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | 2-[(3E,7E,11E)-5-(benzenesulfonyl)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]-1,3-dioxolane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC(/C=C(\C)CCC1OCCO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H44O4S/c1-24(2)11-9-12-25(3)13-10-14-26(4)17-19-29(35(31,32)28-15-7-6-8-16-28)23-27(5)18-20-30-33-21-22-34-30/h6-8,11,13,15-17,23,29-30H,9-10,12,14,18-22H2,1-5H3/b25-13+,26-17+,27-23+ |
| InChIKey | XKRSKIVWMBVHNX-WSODOIEYSA-N |
| XLogP | 7.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.75 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|