C22H22INO5 — CID 10436252
dimethyl (3R,6R)-6-ethenyl-2-(2-iodophenyl)-3-phenyloxazinane-4,4-dicarboxylate (PubChem CID 10436252) has the molecular formula C22H22INO5 and a molecular weight of 507.32 g/mol. Its IUPAC name is dimethyl (3R,6R)-6-ethenyl-2-(2-iodophenyl)-3-phenyloxazinane-4,4-dicarboxylate.
| Compound Name | dimethyl (3R,6R)-6-ethenyl-2-(2-iodophenyl)-3-phenyloxazinane-4,4-dicarboxylate |
|---|---|
| PubChem CID | 10436252 |
| Molecular Formula | C22H22INO5 |
| Molecular Weight | 507.32 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | dimethyl (3R,6R)-6-ethenyl-2-(2-iodophenyl)-3-phenyloxazinane-4,4-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)OC)(C(=O)OC)[C@@H](c2ccccc2)N(c2ccccc2I)O1 |
| InChI | InChI=1S/C22H22INO5/c1-4-16-14-22(20(25)27-2,21(26)28-3)19(15-10-6-5-7-11-15)24(29-16)18-13-9-8-12-17(18)23/h4-13,16,19H,1,14H2,2-3H3/t16-,19+/m0/s1 |
| InChIKey | BAKMKYRQGHCIPU-QFBILLFUSA-N |
| XLogP | 4.06 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|